C24H23BrClN5O3S — CID 69191670
[4-bromo-5-[(2-chlorobenzoyl)amino]-1H-pyrazol-3-yl] N-[6-(1,3-benzothiazol-2-yl)hexyl]carbamate (PubChem CID 69191670) has the molecular formula C24H23BrClN5O3S and a molecular weight of 576.90 g/mol. Its IUPAC name is [4-bromo-5-[(2-chlorobenzoyl)amino]-1H-pyrazol-3-yl] N-[6-(1,3-benzothiazol-2-yl)hexyl]carbamate.
| Compound Name | [4-bromo-5-[(2-chlorobenzoyl)amino]-1H-pyrazol-3-yl] N-[6-(1,3-benzothiazol-2-yl)hexyl]carbamate |
|---|---|
| PubChem CID | 69191670 |
| Molecular Formula | C24H23BrClN5O3S |
| Molecular Weight | 576.90 g/mol |
| Exact Mass | 575.04 |
| IUPAC Name | [4-bromo-5-[(2-chlorobenzoyl)amino]-1H-pyrazol-3-yl] N-[6-(1,3-benzothiazol-2-yl)hexyl]carbamate |
| SMILES | O=C(NCCCCCCc1nc2ccccc2s1)Oc1n[nH]c(NC(=O)c2ccccc2Cl)c1Br |
| InChI | InChI=1S/C24H23BrClN5O3S/c25-20-21(29-22(32)15-9-4-5-10-16(15)26)30-31-23(20)34-24(33)27-14-8-2-1-3-13-19-28-17-11-6-7-12-18(17)35-19/h4-7,9-12H,1-3,8,13-14H2,(H,27,33)(H2,29,30,31,32) |
| InChIKey | FOHYUFOOFUOTNT-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.90 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|