C22H31NO4S2 — CID 69238709
4-[2-[(4S)-4-[(3S)-3-hydroxy-4-(3-propylphenyl)but-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]ethylsulfanyl]butanoic acid (PubChem CID 69238709) has the molecular formula C22H31NO4S2 and a molecular weight of 437.63 g/mol. Its IUPAC name is 4-[2-[(4S)-4-[(3S)-3-hydroxy-4-(3-propylphenyl)but-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]ethylsulfanyl]butanoic acid.
| Compound Name | 4-[2-[(4S)-4-[(3S)-3-hydroxy-4-(3-propylphenyl)but-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]ethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 69238709 |
| Molecular Formula | C22H31NO4S2 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 4-[2-[(4S)-4-[(3S)-3-hydroxy-4-(3-propylphenyl)but-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]ethylsulfanyl]butanoic acid |
| SMILES | CCCc1cccc(C[C@H](O)C=C[C@H]2CSC(=O)N2CCSCCCC(=O)O)c1 |
| InChI | InChI=1S/C22H31NO4S2/c1-2-5-17-6-3-7-18(14-17)15-20(24)10-9-19-16-29-22(27)23(19)11-13-28-12-4-8-21(25)26/h3,6-7,9-10,14,19-20,24H,2,4-5,8,11-13,15-16H2,1H3,(H,25,26)/t19-,20+/m0/s1 |
| InChIKey | QRVTYTUOOOVOOR-VQTJNVASSA-N |
| XLogP | 4.23 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|