C15H15N7S2 — CID 69287988
9-butyl-8-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)purin-6-amine (PubChem CID 69287988) has the molecular formula C15H15N7S2 and a molecular weight of 357.47 g/mol. Its IUPAC name is 9-butyl-8-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)purin-6-amine.
| Compound Name | 9-butyl-8-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)purin-6-amine |
|---|---|
| PubChem CID | 69287988 |
| Molecular Formula | C15H15N7S2 |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 9-butyl-8-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)purin-6-amine |
| SMILES | CCCCn1c(Sc2nc3cccnc3s2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C15H15N7S2/c1-2-3-7-22-12-10(11(16)18-8-19-12)21-14(22)24-15-20-9-5-4-6-17-13(9)23-15/h4-6,8H,2-3,7H2,1H3,(H2,16,18,19) |
| InChIKey | KVERVAALDCSRQI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |