C30H37N5O5 — CID 69446145
1-[3-[4-[6-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]but-1-ynyl]phenyl]-3-pyrimidin-4-ylurea (PubChem CID 69446145) has the molecular formula C30H37N5O5 and a molecular weight of 547.66 g/mol. Its IUPAC name is 1-[3-[4-[6-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]but-1-ynyl]phenyl]-3-pyrimidin-4-ylurea.
| Compound Name | 1-[3-[4-[6-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]but-1-ynyl]phenyl]-3-pyrimidin-4-ylurea |
|---|---|
| PubChem CID | 69446145 |
| Molecular Formula | C30H37N5O5 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | 1-[3-[4-[6-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]but-1-ynyl]phenyl]-3-pyrimidin-4-ylurea |
| SMILES | O=C(Nc1cccc(C#CCCOCCCCCCNC[C@@H](O)c2ccc(O)c(CO)c2)c1)Nc1ccncn1 |
| InChI | InChI=1S/C30H37N5O5/c36-21-25-19-24(11-12-27(25)37)28(38)20-31-14-4-1-2-5-16-40-17-6-3-8-23-9-7-10-26(18-23)34-30(39)35-29-13-15-32-22-33-29/h7,9-13,15,18-19,22,28,31,36-38H,1-2,4-6,14,16-17,20-21H2,(H2,32,33,34,35,39)/t28-/m1/s1 |
| InChIKey | PXZGMTVHMPTIHQ-MUUNZHRXSA-N |
| XLogP | 3.96 |
| TPSA | 148.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|