1,1-dioxo-3,4-dihydro-1λ6,2-benzothiazine-2-carboxylic acid

C9H9NO4S — CID 69449084

IUPAC1,1-dioxo-3,4-dihydro-1λ6,2-benzothiazine-2-carboxylic acid
SMILESO=C(O)N1CCc2ccccc2S1(=O)=O
InChIInChI=1S/C9H9NO4S/c11-9(12)10-6-5-7-3-1-2-4-8(7)15(10,13)14/h1-4H,5-6H2,(H,11,12)
InChIKeyAPVKBYIFNLHQAY-UHFFFAOYSA-N
MW227.24 g/mol
LogP0.91
Rot. Bonds

About 1,1-dioxo-3,4-dihydro-1λ6,2-benzothiazine-2-carboxylic acid

1,1-dioxo-3,4-dihydro-1λ6,2-benzothiazine-2-carboxylic acid (PubChem CID 69449084) has the molecular formula C9H9NO4S and a molecular weight of 227.24 g/mol. Its IUPAC name is 1,1-dioxo-3,4-dihydro-1λ6,2-benzothiazine-2-carboxylic acid.

Molecular Properties

Compound Name1,1-dioxo-3,4-dihydro-1λ6,2-benzothiazine-2-carboxylic acid
PubChem CID69449084
Molecular FormulaC9H9NO4S
Molecular Weight227.24 g/mol
Exact Mass227.03
IUPAC Name1,1-dioxo-3,4-dihydro-1λ6,2-benzothiazine-2-carboxylic acid
SMILESO=C(O)N1CCc2ccccc2S1(=O)=O
InChIInChI=1S/C9H9NO4S/c11-9(12)10-6-5-7-3-1-2-4-8(7)15(10,13)14/h1-4H,5-6H2,(H,11,12)
InChIKeyAPVKBYIFNLHQAY-UHFFFAOYSA-N
XLogP0.91
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.24
LogP ≤ 50.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1,1-dioxo-3,4-dihydro-1λ6,2-benzothiazine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,1-dioxo-3,4-dihydro-1λ6,2-benzothiazine-2-carboxylic acid?
The IUPAC name of 1,1-dioxo-3,4-dihydro-1λ6,2-benzothiazine-2-carboxylic acid (CID 69449084) is 1,1-dioxo-3,4-dihydro-1λ6,2-benzothiazine-2-carboxylic acid.
What is the SMILES notation for 1,1-dioxo-3,4-dihydro-1λ6,2-benzothiazine-2-carboxylic acid?
The canonical SMILES for 1,1-dioxo-3,4-dihydro-1λ6,2-benzothiazine-2-carboxylic acid is O=C(O)N1CCc2ccccc2S1(=O)=O.
What is the InChIKey of 1,1-dioxo-3,4-dihydro-1λ6,2-benzothiazine-2-carboxylic acid?
The InChIKey is APVKBYIFNLHQAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO4S/c11-9(12)10-6-5-7-3-1-2-4-8(7)15(10,13)14/h1-4H,5-6H2,(H,11,12).
What are the key properties of 1,1-dioxo-3,4-dihydro-1λ6,2-benzothiazine-2-carboxylic acid?
1,1-dioxo-3,4-dihydro-1λ6,2-benzothiazine-2-carboxylic acid has a molecular weight of 227.24 g/mol, XLogP of 0.91, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-3,4-dihydro-1λ6,2-benzothiazine-2-carboxylic acid is sourced from PubChem (CID 69449084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).