C13H20ClNOSi — CID 69449546
CID 69449546 (PubChem CID 69449546) has the molecular formula C13H20ClNOSi and a molecular weight of 269.85 g/mol.
| Compound Name | CID 69449546 |
|---|---|
| PubChem CID | 69449546 |
| Molecular Formula | C13H20ClNOSi |
| Molecular Weight | 269.85 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]OC(C)(C)c1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C13H20ClNOSi/c1-12(2,3)17-16-13(4,5)9-6-7-11(15)10(14)8-9/h6-8H,15H2,1-5H3 |
| InChIKey | QLZLZUBCNGQTDC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.85 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|