C20H24N3O2S+ — CID 6987129
1-[(E)-3-phenylprop-2-enyl]-N'-(thiophene-2-carbonyl)piperidin-1-ium-4-carbohydrazide (PubChem CID 6987129) has the molecular formula C20H24N3O2S+ and a molecular weight of 370.50 g/mol. Its IUPAC name is 1-[(E)-3-phenylprop-2-enyl]-N'-(thiophene-2-carbonyl)piperidin-1-ium-4-carbohydrazide.
| Compound Name | 1-[(E)-3-phenylprop-2-enyl]-N'-(thiophene-2-carbonyl)piperidin-1-ium-4-carbohydrazide |
|---|---|
| PubChem CID | 6987129 |
| Molecular Formula | C20H24N3O2S+ |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 1-[(E)-3-phenylprop-2-enyl]-N'-(thiophene-2-carbonyl)piperidin-1-ium-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CC[NH+](C/C=C/c2ccccc2)CC1)c1cccs1 |
| InChI | InChI=1S/C20H23N3O2S/c24-19(21-22-20(25)18-9-5-15-26-18)17-10-13-23(14-11-17)12-4-8-16-6-2-1-3-7-16/h1-9,15,17H,10-14H2,(H,21,24)(H,22,25)/p+1/b8-4+ |
| InChIKey | RVSAQQILTYLTLO-XBXARRHUSA-O |
| XLogP | 1.52 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|