C29H40F4N2 — CID 70027609
5-decyl-2-[4-[(Z)-1,2-difluoronon-1-enyl]-2,3-difluorophenyl]pyrimidine (PubChem CID 70027609) has the molecular formula C29H40F4N2 and a molecular weight of 492.65 g/mol. Its IUPAC name is 5-decyl-2-[4-[(Z)-1,2-difluoronon-1-enyl]-2,3-difluorophenyl]pyrimidine.
| Compound Name | 5-decyl-2-[4-[(Z)-1,2-difluoronon-1-enyl]-2,3-difluorophenyl]pyrimidine |
|---|---|
| PubChem CID | 70027609 |
| Molecular Formula | C29H40F4N2 |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | 5-decyl-2-[4-[(Z)-1,2-difluoronon-1-enyl]-2,3-difluorophenyl]pyrimidine |
| SMILES | CCCCCCCCCCc1cnc(-c2ccc(/C(F)=C(/F)CCCCCCC)c(F)c2F)nc1 |
| InChI | InChI=1S/C29H40F4N2/c1-3-5-7-9-10-11-13-14-16-22-20-34-29(35-21-22)24-19-18-23(27(32)28(24)33)26(31)25(30)17-15-12-8-6-4-2/h18-21H,3-17H2,1-2H3/b26-25- |
| InChIKey | JRWMRPBORZJTNV-QPLCGJKRSA-N |
| XLogP | 10.07 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|