C24H17ClF3N5O6 — CID 70136594
4-amino-3-methyl-6-phenyl-1,2,4-triazin-5-one;5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid (PubChem CID 70136594) has the molecular formula C24H17ClF3N5O6 and a molecular weight of 563.88 g/mol. Its IUPAC name is 4-amino-3-methyl-6-phenyl-1,2,4-triazin-5-one;5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid.
| Compound Name | 4-amino-3-methyl-6-phenyl-1,2,4-triazin-5-one;5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 70136594 |
| Molecular Formula | C24H17ClF3N5O6 |
| Molecular Weight | 563.88 g/mol |
| Exact Mass | 563.08 |
| IUPAC Name | 4-amino-3-methyl-6-phenyl-1,2,4-triazin-5-one;5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid |
| SMILES | Cc1nnc(-c2ccccc2)c(=O)n1N.O=C(O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H7ClF3NO5.C10H10N4O/c15-10-5-7(14(16,17)18)1-4-12(10)24-8-2-3-11(19(22)23)9(6-8)13(20)21;1-7-12-13-9(10(15)14(7)11)8-5-3-2-4-6-8/h1-6H,(H,20,21);2-6H,11H2,1H3 |
| InChIKey | CRBPXOWQVVIVRI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 163.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.88 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|