C30H27Cl2F3N2O9 — CID 70137202
2-[(2-chlorophenyl)methyl]-4,4-dimethyl-1,2-oxazolidin-3-one;(2-ethoxy-2-oxoethyl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate (PubChem CID 70137202) has the molecular formula C30H27Cl2F3N2O9 and a molecular weight of 687.45 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-4,4-dimethyl-1,2-oxazolidin-3-one;(2-ethoxy-2-oxoethyl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate.
| Compound Name | 2-[(2-chlorophenyl)methyl]-4,4-dimethyl-1,2-oxazolidin-3-one;(2-ethoxy-2-oxoethyl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
|---|---|
| PubChem CID | 70137202 |
| Molecular Formula | C30H27Cl2F3N2O9 |
| Molecular Weight | 687.45 g/mol |
| Exact Mass | 686.10 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-4,4-dimethyl-1,2-oxazolidin-3-one;(2-ethoxy-2-oxoethyl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
| SMILES | CC1(C)CON(Cc2ccccc2Cl)C1=O.CCOC(=O)COC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H13ClF3NO7.C12H14ClNO2/c1-2-28-16(24)9-29-17(25)12-8-11(4-5-14(12)23(26)27)30-15-6-3-10(7-13(15)19)18(20,21)22;1-12(2)8-16-14(11(12)15)7-9-5-3-4-6-10(9)13/h3-8H,2,9H2,1H3;3-6H,7-8H2,1-2H3 |
| InChIKey | RSJCXTCSCDKRGL-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 134.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.45 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|