C11H8ClF3O3 — CID 70337941
8-chloro-2-(trifluoromethyl)-8,8a-dihydro-2H-chromene-3-carboxylic acid (PubChem CID 70337941) has the molecular formula C11H8ClF3O3 and a molecular weight of 280.63 g/mol. Its IUPAC name is 8-chloro-2-(trifluoromethyl)-8,8a-dihydro-2H-chromene-3-carboxylic acid.
| Compound Name | 8-chloro-2-(trifluoromethyl)-8,8a-dihydro-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 70337941 |
| Molecular Formula | C11H8ClF3O3 |
| Molecular Weight | 280.63 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 8-chloro-2-(trifluoromethyl)-8,8a-dihydro-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=CC2=CC=CC(Cl)C2OC1C(F)(F)F |
| InChI | InChI=1S/C11H8ClF3O3/c12-7-3-1-2-5-4-6(10(16)17)9(11(13,14)15)18-8(5)7/h1-4,7-9H,(H,16,17) |
| InChIKey | QQACYDCVWHYELU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.63 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|