C19H20O2 — CID 70389001
(13S,14R)-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthrene-3-carboxylic acid (PubChem CID 70389001) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is (13S,14R)-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthrene-3-carboxylic acid.
| Compound Name | (13S,14R)-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthrene-3-carboxylic acid |
|---|---|
| PubChem CID | 70389001 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (13S,14R)-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthrene-3-carboxylic acid |
| SMILES | C[C@@]12CCC[C@H]1c1ccc3cc(C(=O)O)ccc3c1CC2 |
| InChI | InChI=1S/C19H20O2/c1-19-9-2-3-17(19)16-7-4-12-11-13(18(20)21)5-6-14(12)15(16)8-10-19/h4-7,11,17H,2-3,8-10H2,1H3,(H,20,21)/t17-,19-/m0/s1 |
| InChIKey | USVMBQBMLWBGHW-HKUYNNGSSA-N |
| XLogP | 4.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |