C15H20N4O4 — CID 70394266
4-[(6-ethoxycarbonyl-1-ethylpyrazolo[4,3-b]pyridin-7-yl)amino]butanoic acid (PubChem CID 70394266) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is 4-[(6-ethoxycarbonyl-1-ethylpyrazolo[4,3-b]pyridin-7-yl)amino]butanoic acid.
| Compound Name | 4-[(6-ethoxycarbonyl-1-ethylpyrazolo[4,3-b]pyridin-7-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 70394266 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 4-[(6-ethoxycarbonyl-1-ethylpyrazolo[4,3-b]pyridin-7-yl)amino]butanoic acid |
| SMILES | CCOC(=O)c1cnc2cnn(CC)c2c1NCCCC(=O)O |
| InChI | InChI=1S/C15H20N4O4/c1-3-19-14-11(9-18-19)17-8-10(15(22)23-4-2)13(14)16-7-5-6-12(20)21/h8-9H,3-7H2,1-2H3,(H,16,17)(H,20,21) |
| InChIKey | ZZMUXBVSXLGZGD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|