About 5-(2,2-difluoroethenyl)-2-phenyl-5-propoxycyclohexa-1,3-diene
5-(2,2-difluoroethenyl)-2-phenyl-5-propoxycyclohexa-1,3-diene (PubChem CID 70398000) has the molecular formula C17H18F2O
and a molecular weight of 276.33 g/mol. Its IUPAC name is 5-(2,2-difluoroethenyl)-2-phenyl-5-propoxycyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-(2,2-difluoroethenyl)-2-phenyl-5-propoxycyclohexa-1,3-diene |
| PubChem CID | 70398000 |
| Molecular Formula | C17H18F2O |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 5-(2,2-difluoroethenyl)-2-phenyl-5-propoxycyclohexa-1,3-diene |
| SMILES | CCCOC1(C=C(F)F)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C17H18F2O/c1-2-12-20-17(13-16(18)19)10-8-15(9-11-17)14-6-4-3-5-7-14/h3-10,13H,2,11-12H2,1H3 |
| InChIKey | ZFCWPGZNQPZMKS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(2,2-difluoroethenyl)-2-phenyl-5-propoxycyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-difluoroethenyl)-2-phenyl-5-propoxycyclohexa-1,3-diene?
The IUPAC name of 5-(2,2-difluoroethenyl)-2-phenyl-5-propoxycyclohexa-1,3-diene (CID 70398000) is 5-(2,2-difluoroethenyl)-2-phenyl-5-propoxycyclohexa-1,3-diene.
What is the SMILES notation for 5-(2,2-difluoroethenyl)-2-phenyl-5-propoxycyclohexa-1,3-diene?
The canonical SMILES for 5-(2,2-difluoroethenyl)-2-phenyl-5-propoxycyclohexa-1,3-diene is CCCOC1(C=C(F)F)C=CC(c2ccccc2)=CC1.
What is the InChIKey of 5-(2,2-difluoroethenyl)-2-phenyl-5-propoxycyclohexa-1,3-diene?
The InChIKey is ZFCWPGZNQPZMKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18F2O/c1-2-12-20-17(13-16(18)19)10-8-15(9-11-17)14-6-4-3-5-7-14/h3-10,13H,2,11-12H2,1H3.
What are the key properties of 5-(2,2-difluoroethenyl)-2-phenyl-5-propoxycyclohexa-1,3-diene?
5-(2,2-difluoroethenyl)-2-phenyl-5-propoxycyclohexa-1,3-diene has a molecular weight of 276.33 g/mol, XLogP of 4.98, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluoroethenyl)-2-phenyl-5-propoxycyclohexa-1,3-diene is sourced from PubChem (CID 70398000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).