C25H22N6O5S — CID 7042156
6-[(4R)-4-hydroxy-3-[1-(4-methyl-3-nitrophenyl)ethenylamino]-2-pyridin-3-ylimino-1,3-thiazolidin-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 7042156) has the molecular formula C25H22N6O5S and a molecular weight of 518.56 g/mol. Its IUPAC name is 6-[(4R)-4-hydroxy-3-[1-(4-methyl-3-nitrophenyl)ethenylamino]-2-pyridin-3-ylimino-1,3-thiazolidin-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(4R)-4-hydroxy-3-[1-(4-methyl-3-nitrophenyl)ethenylamino]-2-pyridin-3-ylimino-1,3-thiazolidin-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 7042156 |
| Molecular Formula | C25H22N6O5S |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 6-[(4R)-4-hydroxy-3-[1-(4-methyl-3-nitrophenyl)ethenylamino]-2-pyridin-3-ylimino-1,3-thiazolidin-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | C=C(NN1/C(=N/c2cccnc2)SC[C@]1(O)c1ccc2c(c1)NC(=O)CO2)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H22N6O5S/c1-15-5-6-17(10-21(15)31(34)35)16(2)29-30-24(27-19-4-3-9-26-12-19)37-14-25(30,33)18-7-8-22-20(11-18)28-23(32)13-36-22/h3-12,29,33H,2,13-14H2,1H3,(H,28,32)/b27-24-/t25-/m0/s1 |
| InChIKey | FSNHFGNKXXIKNI-RYJBYELZSA-N |
| XLogP | 3.69 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|