C22H24F2N2O5S — CID 70438760
N-(2,2-difluoro-4-hydroxybutyl)-N-[3-(1,3-dioxoisoindol-2-yl)propyl]-2-methylbenzenesulfonamide (PubChem CID 70438760) has the molecular formula C22H24F2N2O5S and a molecular weight of 466.51 g/mol. Its IUPAC name is N-(2,2-difluoro-4-hydroxybutyl)-N-[3-(1,3-dioxoisoindol-2-yl)propyl]-2-methylbenzenesulfonamide.
| Compound Name | N-(2,2-difluoro-4-hydroxybutyl)-N-[3-(1,3-dioxoisoindol-2-yl)propyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 70438760 |
| Molecular Formula | C22H24F2N2O5S |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | N-(2,2-difluoro-4-hydroxybutyl)-N-[3-(1,3-dioxoisoindol-2-yl)propyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccccc1S(=O)(=O)N(CCCN1C(=O)c2ccccc2C1=O)CC(F)(F)CCO |
| InChI | InChI=1S/C22H24F2N2O5S/c1-16-7-2-5-10-19(16)32(30,31)25(15-22(23,24)11-14-27)12-6-13-26-20(28)17-8-3-4-9-18(17)21(26)29/h2-5,7-10,27H,6,11-15H2,1H3 |
| InChIKey | PRXLQYFUELDMIV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|