C22H37NO7S — CID 70486966
5-[(4R,5R)-5-hydroxy-4-[(E,3S)-3-hydroxy-4-methyloct-1-enyl]-5,6-dihydro-4H-cyclopenta[b]furan-2-yl]pentanoic acid;methanesulfonamide (PubChem CID 70486966) has the molecular formula C22H37NO7S and a molecular weight of 459.61 g/mol. Its IUPAC name is 5-[(4R,5R)-5-hydroxy-4-[(E,3S)-3-hydroxy-4-methyloct-1-enyl]-5,6-dihydro-4H-cyclopenta[b]furan-2-yl]pentanoic acid;methanesulfonamide.
| Compound Name | 5-[(4R,5R)-5-hydroxy-4-[(E,3S)-3-hydroxy-4-methyloct-1-enyl]-5,6-dihydro-4H-cyclopenta[b]furan-2-yl]pentanoic acid;methanesulfonamide |
|---|---|
| PubChem CID | 70486966 |
| Molecular Formula | C22H37NO7S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 5-[(4R,5R)-5-hydroxy-4-[(E,3S)-3-hydroxy-4-methyloct-1-enyl]-5,6-dihydro-4H-cyclopenta[b]furan-2-yl]pentanoic acid;methanesulfonamide |
| SMILES | CCCCC(C)[C@H](O)/C=C/[C@@H]1c2cc(CCCCC(=O)O)oc2C[C@H]1O.CS(N)(=O)=O |
| InChI | InChI=1S/C21H32O5.CH5NO2S/c1-3-4-7-14(2)18(22)11-10-16-17-12-15(8-5-6-9-21(24)25)26-20(17)13-19(16)23;1-5(2,3)4/h10-12,14,16,18-19,22-23H,3-9,13H2,1-2H3,(H,24,25);1H3,(H2,2,3,4)/b11-10+;/t14?,16-,18-,19-;/m1./s1 |
| InChIKey | CNBHURKWQWGMOG-JFURQOIQSA-N |
| XLogP | 2.73 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|