C22H35NO6S — CID 70486968
5-[(4R,5R)-5-hydroxy-4-[(3S,4S)-3-hydroxy-4-methyloct-1-enyl]-5,6-dihydro-4H-cyclopenta[b]furan-2-yl]-N-methylsulfonylpentanamide (PubChem CID 70486968) has the molecular formula C22H35NO6S and a molecular weight of 441.59 g/mol. Its IUPAC name is 5-[(4R,5R)-5-hydroxy-4-[(3S,4S)-3-hydroxy-4-methyloct-1-enyl]-5,6-dihydro-4H-cyclopenta[b]furan-2-yl]-N-methylsulfonylpentanamide.
| Compound Name | 5-[(4R,5R)-5-hydroxy-4-[(3S,4S)-3-hydroxy-4-methyloct-1-enyl]-5,6-dihydro-4H-cyclopenta[b]furan-2-yl]-N-methylsulfonylpentanamide |
|---|---|
| PubChem CID | 70486968 |
| Molecular Formula | C22H35NO6S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 5-[(4R,5R)-5-hydroxy-4-[(3S,4S)-3-hydroxy-4-methyloct-1-enyl]-5,6-dihydro-4H-cyclopenta[b]furan-2-yl]-N-methylsulfonylpentanamide |
| SMILES | CCCC[C@H](C)[C@H](O)C=C[C@@H]1c2cc(CCCCC(=O)NS(C)(=O)=O)oc2C[C@H]1O |
| InChI | InChI=1S/C22H35NO6S/c1-4-5-8-15(2)19(24)12-11-17-18-13-16(29-21(18)14-20(17)25)9-6-7-10-22(26)23-30(3,27)28/h11-13,15,17,19-20,24-25H,4-10,14H2,1-3H3,(H,23,26)/t15-,17+,19+,20+/m0/s1 |
| InChIKey | WFZVYKBRUCWMEK-JQERWDHBSA-N |
| XLogP | 2.81 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|