C18H26N2O5 — CID 70505446
(2S)-2-amino-3-[4-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]oxycyclohexyl]propanoic acid (PubChem CID 70505446) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]oxycyclohexyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]oxycyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 70505446 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | (2S)-2-amino-3-[4-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]oxycyclohexyl]propanoic acid |
| SMILES | N[C@@H](CC1CCC(OC(=O)[C@@H](N)Cc2ccc(O)cc2)CC1)C(=O)O |
| InChI | InChI=1S/C18H26N2O5/c19-15(17(22)23)9-12-3-7-14(8-4-12)25-18(24)16(20)10-11-1-5-13(21)6-2-11/h1-2,5-6,12,14-16,21H,3-4,7-10,19-20H2,(H,22,23)/t12?,14?,15-,16-/m0/s1 |
| InChIKey | QNWTWGXZFWOJSA-UAOKOLBASA-N |
| XLogP | 1.17 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |