C29H41NO5 — CID 70509224
heptanoic acid;(1S,2S,4S)-2-morpholin-4-yl-4-[(4-phenylphenyl)methoxy]cyclopentan-1-ol (PubChem CID 70509224) has the molecular formula C29H41NO5 and a molecular weight of 483.65 g/mol. Its IUPAC name is heptanoic acid;(1S,2S,4S)-2-morpholin-4-yl-4-[(4-phenylphenyl)methoxy]cyclopentan-1-ol.
| Compound Name | heptanoic acid;(1S,2S,4S)-2-morpholin-4-yl-4-[(4-phenylphenyl)methoxy]cyclopentan-1-ol |
|---|---|
| PubChem CID | 70509224 |
| Molecular Formula | C29H41NO5 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | heptanoic acid;(1S,2S,4S)-2-morpholin-4-yl-4-[(4-phenylphenyl)methoxy]cyclopentan-1-ol |
| SMILES | CCCCCCC(=O)O.O[C@H]1C[C@@H](OCc2ccc(-c3ccccc3)cc2)C[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C22H27NO3.C7H14O2/c24-22-15-20(14-21(22)23-10-12-25-13-11-23)26-16-17-6-8-19(9-7-17)18-4-2-1-3-5-18;1-2-3-4-5-6-7(8)9/h1-9,20-22,24H,10-16H2;2-6H2,1H3,(H,8,9)/t20-,21-,22-;/m0./s1 |
| InChIKey | BOLOKCWBGAIFLL-SGIIKHNDSA-N |
| XLogP | 5.14 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|