C10H12Cl4 — CID 70567653
1,1,1,2-tetrachloroethane;1,2-xylene (PubChem CID 70567653) has the molecular formula C10H12Cl4 and a molecular weight of 274.02 g/mol. Its IUPAC name is 1,1,1,2-tetrachloroethane;1,2-xylene.
| Compound Name | 1,1,1,2-tetrachloroethane;1,2-xylene |
|---|---|
| PubChem CID | 70567653 |
| Molecular Formula | C10H12Cl4 |
| Molecular Weight | 274.02 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 1,1,1,2-tetrachloroethane;1,2-xylene |
| SMILES | Cc1ccccc1C.ClCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H10.C2H2Cl4/c1-7-5-3-4-6-8(7)2;3-1-2(4,5)6/h3-6H,1-2H3;1H2 |
| InChIKey | UZKOTSREMDVZMP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.02 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|