C17H19NOS2 — CID 70584202
2-(1,3-benzothiazol-2-ylsulfanyl)-2-[(Z)-pent-2-enyl]cyclopentan-1-one (PubChem CID 70584202) has the molecular formula C17H19NOS2 and a molecular weight of 317.48 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-2-[(Z)-pent-2-enyl]cyclopentan-1-one.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-2-[(Z)-pent-2-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 70584202 |
| Molecular Formula | C17H19NOS2 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-2-[(Z)-pent-2-enyl]cyclopentan-1-one |
| SMILES | CC/C=C\CC1(Sc2nc3ccccc3s2)CCCC1=O |
| InChI | InChI=1S/C17H19NOS2/c1-2-3-6-11-17(12-7-10-15(17)19)21-16-18-13-8-4-5-9-14(13)20-16/h3-6,8-9H,2,7,10-12H2,1H3/b6-3- |
| InChIKey | BXPJYJPBOPUTEQ-UTCJRWHESA-N |
| XLogP | 5.24 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|