C11H20N4O+2 — CID 7062722
2-ethanimidoyl-4-(4-methylpiperazine-1,4-diium-1-yl)-3-oxobutanenitrile (PubChem CID 7062722) has the molecular formula C11H20N4O+2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-ethanimidoyl-4-(4-methylpiperazine-1,4-diium-1-yl)-3-oxobutanenitrile.
| Compound Name | 2-ethanimidoyl-4-(4-methylpiperazine-1,4-diium-1-yl)-3-oxobutanenitrile |
|---|---|
| PubChem CID | 7062722 |
| Molecular Formula | C11H20N4O+2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2-ethanimidoyl-4-(4-methylpiperazine-1,4-diium-1-yl)-3-oxobutanenitrile |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)C[NH+]1CC[NH+](C)CC1 |
| InChI | InChI=1S/C11H18N4O/c1-9(13)10(7-12)11(16)8-15-5-3-14(2)4-6-15/h10,13H,3-6,8H2,1-2H3/p+2/b13-9+ |
| InChIKey | QIGBMSVRVNOJAA-UKTHLTGXSA-P |
| XLogP | -2.85 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|