C24H29N5O6S2 — CID 70657339
[3-[(1R)-2-[2-[(3-ethyl-2H-indazol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl] 2-acetamido-2H-1,3-thiazole-3-sulfonate (PubChem CID 70657339) has the molecular formula C24H29N5O6S2 and a molecular weight of 547.66 g/mol. Its IUPAC name is [3-[(1R)-2-[2-[(3-ethyl-2H-indazol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl] 2-acetamido-2H-1,3-thiazole-3-sulfonate.
| Compound Name | [3-[(1R)-2-[2-[(3-ethyl-2H-indazol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl] 2-acetamido-2H-1,3-thiazole-3-sulfonate |
|---|---|
| PubChem CID | 70657339 |
| Molecular Formula | C24H29N5O6S2 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | [3-[(1R)-2-[2-[(3-ethyl-2H-indazol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl] 2-acetamido-2H-1,3-thiazole-3-sulfonate |
| SMILES | CCc1[nH]nc2cc(OCCNC[C@H](O)c3cccc(OS(=O)(=O)N4C=CSC4NC(C)=O)c3)ccc12 |
| InChI | InChI=1S/C24H29N5O6S2/c1-3-21-20-8-7-18(14-22(20)28-27-21)34-11-9-25-15-23(31)17-5-4-6-19(13-17)35-37(32,33)29-10-12-36-24(29)26-16(2)30/h4-8,10,12-14,23-25,31H,3,9,11,15H2,1-2H3,(H,26,30)(H,27,28)/t23-,24?/m0/s1 |
| InChIKey | MBXALWOOUAUEBP-UXMRNZNESA-N |
| XLogP | 2.39 |
| TPSA | 145.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|