C30H40NOP — CID 71039808
4-benzyl-2-[2-[2-[(tert-butylamino)methyl]-4-methylphenyl]phosphanylpentan-2-yl]phenol (PubChem CID 71039808) has the molecular formula C30H40NOP and a molecular weight of 461.63 g/mol. Its IUPAC name is 4-benzyl-2-[2-[2-[(tert-butylamino)methyl]-4-methylphenyl]phosphanylpentan-2-yl]phenol.
| Compound Name | 4-benzyl-2-[2-[2-[(tert-butylamino)methyl]-4-methylphenyl]phosphanylpentan-2-yl]phenol |
|---|---|
| PubChem CID | 71039808 |
| Molecular Formula | C30H40NOP |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | 4-benzyl-2-[2-[2-[(tert-butylamino)methyl]-4-methylphenyl]phosphanylpentan-2-yl]phenol |
| SMILES | CCCC(C)(Pc1ccc(C)cc1CNC(C)(C)C)c1cc(Cc2ccccc2)ccc1O |
| InChI | InChI=1S/C30H40NOP/c1-7-17-30(6,33-28-16-13-22(2)18-25(28)21-31-29(3,4)5)26-20-24(14-15-27(26)32)19-23-11-9-8-10-12-23/h8-16,18,20,31-33H,7,17,19,21H2,1-6H3 |
| InChIKey | RUAOGOIJXVGMHX-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|