C16H12N4 — CID 71080279
2-(1,2-dihydroquinoxalin-2-yl)quinoxaline (PubChem CID 71080279) has the molecular formula C16H12N4 and a molecular weight of 260.30 g/mol. Its IUPAC name is 2-(1,2-dihydroquinoxalin-2-yl)quinoxaline.
| Compound Name | 2-(1,2-dihydroquinoxalin-2-yl)quinoxaline |
|---|---|
| PubChem CID | 71080279 |
| Molecular Formula | C16H12N4 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-(1,2-dihydroquinoxalin-2-yl)quinoxaline |
| SMILES | C1=Nc2ccccc2NC1c1cnc2ccccc2n1 |
| InChI | InChI=1S/C16H12N4/c1-3-7-13-11(5-1)17-9-15(19-13)16-10-18-12-6-2-4-8-14(12)20-16/h1-10,15,19H |
| InChIKey | IXEHZXQCUFGVGV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |