C21H24O — CID 71113171
3-methyl-4-(2,9,9-trimethylfluoren-3-yl)butan-2-one (PubChem CID 71113171) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is 3-methyl-4-(2,9,9-trimethylfluoren-3-yl)butan-2-one.
| Compound Name | 3-methyl-4-(2,9,9-trimethylfluoren-3-yl)butan-2-one |
|---|---|
| PubChem CID | 71113171 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 3-methyl-4-(2,9,9-trimethylfluoren-3-yl)butan-2-one |
| SMILES | CC(=O)C(C)Cc1cc2c(cc1C)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C21H24O/c1-13(15(3)22)10-16-12-18-17-8-6-7-9-19(17)21(4,5)20(18)11-14(16)2/h6-9,11-13H,10H2,1-5H3 |
| InChIKey | CABAQFXMWDOUMC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |