C26H35FN6O10 — CID 71275723
(2S)-2-[[(1S)-5-[[3-[amino-[(Z)-5-fluoro-2-(methylideneamino)pent-1-enyl]amino]-5-carboxybenzoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid (PubChem CID 71275723) has the molecular formula C26H35FN6O10 and a molecular weight of 610.60 g/mol. Its IUPAC name is (2S)-2-[[(1S)-5-[[3-[amino-[(Z)-5-fluoro-2-(methylideneamino)pent-1-enyl]amino]-5-carboxybenzoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-5-[[3-[amino-[(Z)-5-fluoro-2-(methylideneamino)pent-1-enyl]amino]-5-carboxybenzoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 71275723 |
| Molecular Formula | C26H35FN6O10 |
| Molecular Weight | 610.60 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | (2S)-2-[[(1S)-5-[[3-[amino-[(Z)-5-fluoro-2-(methylideneamino)pent-1-enyl]amino]-5-carboxybenzoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
| SMILES | C=N/C(=C\N(N)c1cc(C(=O)O)cc(C(=O)NCCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O)c1)CCCF |
| InChI | InChI=1S/C26H35FN6O10/c1-29-17(5-4-9-27)14-33(28)18-12-15(11-16(13-18)23(37)38)22(36)30-10-3-2-6-19(24(39)40)31-26(43)32-20(25(41)42)7-8-21(34)35/h11-14,19-20H,1-10,28H2,(H,30,36)(H,34,35)(H,37,38)(H,39,40)(H,41,42)(H2,31,32,43)/b17-14-/t19-,20-/m0/s1 |
| InChIKey | KUTAQLQDCCHARS-BRFCZWIWSA-N |
| XLogP | 1.33 |
| TPSA | 261.05 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.60 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|