C28H34F3N3O7S — CID 71316895
(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-[2-[4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethoxy]oxane-2-carboxylic acid (PubChem CID 71316895) has the molecular formula C28H34F3N3O7S and a molecular weight of 613.66 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-[2-[4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethoxy]oxane-2-carboxylic acid.
| Compound Name | (2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-[2-[4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 71316895 |
| Molecular Formula | C28H34F3N3O7S |
| Molecular Weight | 613.66 g/mol |
| Exact Mass | 613.21 |
| IUPAC Name | (2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-[2-[4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethoxy]oxane-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1O[C@H](OCCN2CCN(CCCN3c4ccccc4Sc4ccc(C(F)(F)F)cc43)CC2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C28H34F3N3O7S/c29-28(30,31)17-6-7-21-19(16-17)34(18-4-1-2-5-20(18)42-21)9-3-8-32-10-12-33(13-11-32)14-15-40-27-24(37)22(35)23(36)25(41-27)26(38)39/h1-2,4-7,16,22-25,27,35-37H,3,8-15H2,(H,38,39)/t22-,23-,24+,25-,27+/m1/s1 |
| InChIKey | FPAXYGQWHAIDFV-NUPXYHBHSA-N |
| XLogP | 2.22 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.66 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |