C11H8F8O — CID 71335860
4-(2,2,3,3,4,4,5,5-octafluoropentyl)phenol (PubChem CID 71335860) has the molecular formula C11H8F8O and a molecular weight of 308.17 g/mol. Its IUPAC name is 4-(2,2,3,3,4,4,5,5-octafluoropentyl)phenol.
| Compound Name | 4-(2,2,3,3,4,4,5,5-octafluoropentyl)phenol |
|---|---|
| PubChem CID | 71335860 |
| Molecular Formula | C11H8F8O |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 4-(2,2,3,3,4,4,5,5-octafluoropentyl)phenol |
| SMILES | Oc1ccc(CC(F)(F)C(F)(F)C(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C11H8F8O/c12-8(13)10(16,17)11(18,19)9(14,15)5-6-1-3-7(20)4-2-6/h1-4,8,20H,5H2 |
| InChIKey | KZKQWODQMBXZOD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|