C15H13NO5S — CID 71339854
2-[2-(furan-3-ylmethylsulfonyl)ethyl]isoindole-1,3-dione (PubChem CID 71339854) has the molecular formula C15H13NO5S and a molecular weight of 319.34 g/mol. Its IUPAC name is 2-[2-(furan-3-ylmethylsulfonyl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(furan-3-ylmethylsulfonyl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 71339854 |
| Molecular Formula | C15H13NO5S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 2-[2-(furan-3-ylmethylsulfonyl)ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCS(=O)(=O)Cc1ccoc1 |
| InChI | InChI=1S/C15H13NO5S/c17-14-12-3-1-2-4-13(12)15(18)16(14)6-8-22(19,20)10-11-5-7-21-9-11/h1-5,7,9H,6,8,10H2 |
| InChIKey | FYHZTBNAUKSEDD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|