About 3-aminopropyl-tris(2,4,6-trimethoxyphenyl)phosphanium
3-aminopropyl-tris(2,4,6-trimethoxyphenyl)phosphanium (PubChem CID 71361775) has the molecular formula C30H41NO9P+
and a molecular weight of 590.63 g/mol. Its IUPAC name is 3-aminopropyl-tris(2,4,6-trimethoxyphenyl)phosphanium.
Molecular Properties
| Compound Name | 3-aminopropyl-tris(2,4,6-trimethoxyphenyl)phosphanium |
| PubChem CID | 71361775 |
| Molecular Formula | C30H41NO9P+ |
| Molecular Weight | 590.63 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | 3-aminopropyl-tris(2,4,6-trimethoxyphenyl)phosphanium |
| SMILES | COc1cc(OC)c([P+](CCCN)(c2c(OC)cc(OC)cc2OC)c2c(OC)cc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C30H41NO9P/c1-32-19-13-22(35-4)28(23(14-19)36-5)41(12-10-11-31,29-24(37-6)15-20(33-2)16-25(29)38-7)30-26(39-8)17-21(34-3)18-27(30)40-9/h13-18H,10-12,31H2,1-9H3/q+1 |
| InChIKey | SBJOVIORHHXBRQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 109.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 590.63 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopropyl-tris(2,4,6-trimethoxyphenyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopropyl-tris(2,4,6-trimethoxyphenyl)phosphanium?
The IUPAC name of 3-aminopropyl-tris(2,4,6-trimethoxyphenyl)phosphanium (CID 71361775) is 3-aminopropyl-tris(2,4,6-trimethoxyphenyl)phosphanium.
What is the SMILES notation for 3-aminopropyl-tris(2,4,6-trimethoxyphenyl)phosphanium?
The canonical SMILES for 3-aminopropyl-tris(2,4,6-trimethoxyphenyl)phosphanium is COc1cc(OC)c([P+](CCCN)(c2c(OC)cc(OC)cc2OC)c2c(OC)cc(OC)cc2OC)c(OC)c1.
What is the InChIKey of 3-aminopropyl-tris(2,4,6-trimethoxyphenyl)phosphanium?
The InChIKey is SBJOVIORHHXBRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H41NO9P/c1-32-19-13-22(35-4)28(23(14-19)36-5)41(12-10-11-31,29-24(37-6)15-20(33-2)16-25(29)38-7)30-26(39-8)17-21(34-3)18-27(30)40-9/h13-18H,10-12,31H2,1-9H3/q+1.
What are the key properties of 3-aminopropyl-tris(2,4,6-trimethoxyphenyl)phosphanium?
3-aminopropyl-tris(2,4,6-trimethoxyphenyl)phosphanium has a molecular weight of 590.63 g/mol, XLogP of 3.41, 15 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopropyl-tris(2,4,6-trimethoxyphenyl)phosphanium is sourced from PubChem (CID 71361775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).