C8H6Br2O2 — CID 71375417
3,4-dibromo-5-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-2-one (PubChem CID 71375417) has the molecular formula C8H6Br2O2 and a molecular weight of 293.94 g/mol. Its IUPAC name is 3,4-dibromo-5-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-2-one.
| Compound Name | 3,4-dibromo-5-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-2-one |
|---|---|
| PubChem CID | 71375417 |
| Molecular Formula | C8H6Br2O2 |
| Molecular Weight | 293.94 g/mol |
| Exact Mass | 291.87 |
| IUPAC Name | 3,4-dibromo-5-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-2-one |
| SMILES | CC12C=CC(O1)C(=O)C(Br)=C2Br |
| InChI | InChI=1S/C8H6Br2O2/c1-8-3-2-4(12-8)6(11)5(9)7(8)10/h2-4H,1H3 |
| InChIKey | DJIGFGZBJRACBR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.94 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|