C19H32O2S — CID 71498493
methyl 2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]sulfanylacetate (PubChem CID 71498493) has the molecular formula C19H32O2S and a molecular weight of 324.53 g/mol. Its IUPAC name is methyl 2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]sulfanylacetate.
| Compound Name | methyl 2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]sulfanylacetate |
|---|---|
| PubChem CID | 71498493 |
| Molecular Formula | C19H32O2S |
| Molecular Weight | 324.53 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | methyl 2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]sulfanylacetate |
| SMILES | COC(=O)CSCC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C19H32O2S/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-22-15-19(20)21-5/h9,11,13H,6-8,10,12,14-15H2,1-5H3/b17-11+,18-13+ |
| InChIKey | JOVGNXHZVRLZRA-OUBUNXTGSA-N |
| XLogP | 5.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|