C38H50ClN5O4 — CID 71499508
4-[(4-chlorophenyl)methyl]-2-(1-methylazepan-4-yl)phthalazin-1-one;2-(diethylamino)ethyl 3-amino-4-propoxybenzoate (PubChem CID 71499508) has the molecular formula C38H50ClN5O4 and a molecular weight of 676.30 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-2-(1-methylazepan-4-yl)phthalazin-1-one;2-(diethylamino)ethyl 3-amino-4-propoxybenzoate.
| Compound Name | 4-[(4-chlorophenyl)methyl]-2-(1-methylazepan-4-yl)phthalazin-1-one;2-(diethylamino)ethyl 3-amino-4-propoxybenzoate |
|---|---|
| PubChem CID | 71499508 |
| Molecular Formula | C38H50ClN5O4 |
| Molecular Weight | 676.30 g/mol |
| Exact Mass | 675.36 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-2-(1-methylazepan-4-yl)phthalazin-1-one;2-(diethylamino)ethyl 3-amino-4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)OCCN(CC)CC)cc1N.CN1CCCC(n2nc(Cc3ccc(Cl)cc3)c3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C22H24ClN3O.C16H26N2O3/c1-25-13-4-5-18(12-14-25)26-22(27)20-7-3-2-6-19(20)21(24-26)15-16-8-10-17(23)11-9-16;1-4-10-20-15-8-7-13(12-14(15)17)16(19)21-11-9-18(5-2)6-3/h2-3,6-11,18H,4-5,12-15H2,1H3;7-8,12H,4-6,9-11,17H2,1-3H3 |
| InChIKey | UTOXEVMYDGPFNS-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.30 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|