C23H33NO3 — CID 71529387
(2E,4E,9E)-11-(3,4-dimethoxyphenyl)-N-(2-methylpropyl)undeca-2,4,9-trienamide (PubChem CID 71529387) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is (2E,4E,9E)-11-(3,4-dimethoxyphenyl)-N-(2-methylpropyl)undeca-2,4,9-trienamide.
| Compound Name | (2E,4E,9E)-11-(3,4-dimethoxyphenyl)-N-(2-methylpropyl)undeca-2,4,9-trienamide |
|---|---|
| PubChem CID | 71529387 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | (2E,4E,9E)-11-(3,4-dimethoxyphenyl)-N-(2-methylpropyl)undeca-2,4,9-trienamide |
| SMILES | COc1ccc(C/C=C/CCC/C=C/C=C/C(=O)NCC(C)C)cc1OC |
| InChI | InChI=1S/C23H33NO3/c1-19(2)18-24-23(25)14-12-10-8-6-5-7-9-11-13-20-15-16-21(26-3)22(17-20)27-4/h8-12,14-17,19H,5-7,13,18H2,1-4H3,(H,24,25)/b10-8+,11-9+,14-12+ |
| InChIKey | UUTRIIGZWQCVBD-YXULGHPXSA-N |
| XLogP | 4.86 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|