C27H17F3O5 — CID 71593974
4-hydroxy-3-[(1-hydroxy-3-oxo-4H-naphthalen-2-yl)-[4-(trifluoromethyl)phenyl]methyl]chromen-2-one (PubChem CID 71593974) has the molecular formula C27H17F3O5 and a molecular weight of 478.42 g/mol. Its IUPAC name is 4-hydroxy-3-[(1-hydroxy-3-oxo-4H-naphthalen-2-yl)-[4-(trifluoromethyl)phenyl]methyl]chromen-2-one.
| Compound Name | 4-hydroxy-3-[(1-hydroxy-3-oxo-4H-naphthalen-2-yl)-[4-(trifluoromethyl)phenyl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 71593974 |
| Molecular Formula | C27H17F3O5 |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 4-hydroxy-3-[(1-hydroxy-3-oxo-4H-naphthalen-2-yl)-[4-(trifluoromethyl)phenyl]methyl]chromen-2-one |
| SMILES | O=C1Cc2ccccc2C(O)=C1C(c1ccc(C(F)(F)F)cc1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C27H17F3O5/c28-27(29,30)16-11-9-14(10-12-16)21(22-19(31)13-15-5-1-2-6-17(15)24(22)32)23-25(33)18-7-3-4-8-20(18)35-26(23)34/h1-12,21,32-33H,13H2 |
| InChIKey | FIVYWXNUHAEVHK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|