C28H30Cl2N6O2 — CID 71679177
N-(2-aminophenyl)-4-[[[2-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]acetyl]amino]methyl]benzamide (PubChem CID 71679177) has the molecular formula C28H30Cl2N6O2 and a molecular weight of 553.49 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[2-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]acetyl]amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[[2-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]acetyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 71679177 |
| Molecular Formula | C28H30Cl2N6O2 |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[2-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]acetyl]amino]methyl]benzamide |
| SMILES | Cn1c(CC(=O)NCc2ccc(C(=O)Nc3ccccc3N)cc2)nc2cc(N(CCCl)CCCl)ccc21 |
| InChI | InChI=1S/C28H30Cl2N6O2/c1-35-25-11-10-21(36(14-12-29)15-13-30)16-24(25)33-26(35)17-27(37)32-18-19-6-8-20(9-7-19)28(38)34-23-5-3-2-4-22(23)31/h2-11,16H,12-15,17-18,31H2,1H3,(H,32,37)(H,34,38) |
| InChIKey | FSBMBZFNBJHLBM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 105.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|