C27H25N3O2 — CID 7206806
4-[(E)-4-[4-(dimethylamino)phenyl]but-3-en-2-ylidene]-1,2-diphenylpyrazolidine-3,5-dione (PubChem CID 7206806) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 4-[(E)-4-[4-(dimethylamino)phenyl]but-3-en-2-ylidene]-1,2-diphenylpyrazolidine-3,5-dione.
| Compound Name | 4-[(E)-4-[4-(dimethylamino)phenyl]but-3-en-2-ylidene]-1,2-diphenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 7206806 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 4-[(E)-4-[4-(dimethylamino)phenyl]but-3-en-2-ylidene]-1,2-diphenylpyrazolidine-3,5-dione |
| SMILES | CC(/C=C/c1ccc(N(C)C)cc1)=C1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C27H25N3O2/c1-20(14-15-21-16-18-22(19-17-21)28(2)3)25-26(31)29(23-10-6-4-7-11-23)30(27(25)32)24-12-8-5-9-13-24/h4-19H,1-3H3/b15-14+ |
| InChIKey | ZSROSRQGXIHPJY-CCEZHUSRSA-N |
| XLogP | 5.08 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|