C24H36N2O5Si — CID 72503373
10-O-propyl 9-O-(2-trimethylsilylethyl) 11-(dimethylhydrazinylidene)-4-hydroxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate (PubChem CID 72503373) has the molecular formula C24H36N2O5Si and a molecular weight of 460.65 g/mol. Its IUPAC name is 10-O-propyl 9-O-(2-trimethylsilylethyl) 11-(dimethylhydrazinylidene)-4-hydroxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate.
| Compound Name | 10-O-propyl 9-O-(2-trimethylsilylethyl) 11-(dimethylhydrazinylidene)-4-hydroxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 72503373 |
| Molecular Formula | C24H36N2O5Si |
| Molecular Weight | 460.65 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 10-O-propyl 9-O-(2-trimethylsilylethyl) 11-(dimethylhydrazinylidene)-4-hydroxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
| SMILES | CCCOC(=O)C1C2C(=NN(C)C)CC(c3ccc(O)cc32)C1C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C24H36N2O5Si/c1-7-10-30-24(29)22-20-17-13-15(27)8-9-16(17)18(14-19(20)25-26(2)3)21(22)23(28)31-11-12-32(4,5)6/h8-9,13,18,20-22,27H,7,10-12,14H2,1-6H3 |
| InChIKey | RZWDBSWDASZBLO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.65 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|