C24H27Cl4F2N2O10PS2 — CID 72946955
[(1R,2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propyl] [(1S,2R)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propyl] hydrogen phosphate (PubChem CID 72946955) has the molecular formula C24H27Cl4F2N2O10PS2 and a molecular weight of 778.40 g/mol. Its IUPAC name is [(1R,2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propyl] [(1S,2R)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propyl] hydrogen phosphate.
| Compound Name | [(1R,2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propyl] [(1S,2R)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propyl] hydrogen phosphate |
|---|---|
| PubChem CID | 72946955 |
| Molecular Formula | C24H27Cl4F2N2O10PS2 |
| Molecular Weight | 778.40 g/mol |
| Exact Mass | 775.96 |
| IUPAC Name | [(1R,2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propyl] [(1S,2R)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propyl] hydrogen phosphate |
| SMILES | CS(=O)(=O)c1ccc([C@@H](OP(=O)(O)O[C@@H](c2ccc(S(C)(=O)=O)cc2)[C@H](CF)NC(=O)C(Cl)Cl)[C@@H](CF)NC(=O)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C24H27Cl4F2N2O10PS2/c1-44(37,38)15-7-3-13(4-8-15)19(17(11-29)31-23(33)21(25)26)41-43(35,36)42-20(18(12-30)32-24(34)22(27)28)14-5-9-16(10-6-14)45(2,39)40/h3-10,17-22H,11-12H2,1-2H3,(H,31,33)(H,32,34)(H,35,36)/t17-,18+,19-,20+ |
| InChIKey | MMCXVSMXDYOAKM-FGYAAKKASA-N |
| XLogP | 3.93 |
| TPSA | 182.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|