C17H24Cl3FN2O6S — CID 69229614
[2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propyl] 3-(methylamino)propyl carbonate;hydrochloride (PubChem CID 69229614) has the molecular formula C17H24Cl3FN2O6S and a molecular weight of 509.81 g/mol. Its IUPAC name is [2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propyl] 3-(methylamino)propyl carbonate;hydrochloride.
| Compound Name | [2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propyl] 3-(methylamino)propyl carbonate;hydrochloride |
|---|---|
| PubChem CID | 69229614 |
| Molecular Formula | C17H24Cl3FN2O6S |
| Molecular Weight | 509.81 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | [2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propyl] 3-(methylamino)propyl carbonate;hydrochloride |
| SMILES | CNCCCOC(=O)OC(c1ccc(S(C)(=O)=O)cc1)C(CF)NC(=O)C(Cl)Cl.Cl |
| InChI | InChI=1S/C17H23Cl2FN2O6S.ClH/c1-21-8-3-9-27-17(24)28-14(13(10-20)22-16(23)15(18)19)11-4-6-12(7-5-11)29(2,25)26;/h4-7,13-15,21H,3,8-10H2,1-2H3,(H,22,23);1H |
| InChIKey | ONVPZXUEGWPNRB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.81 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|