C16H17Cl2FNNaO7S — CID 25104465
sodium 4-[(2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propoxy]-4-oxobutanoate (PubChem CID 25104465) has the molecular formula C16H17Cl2FNNaO7S and a molecular weight of 480.27 g/mol. Its IUPAC name is sodium 4-[(2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propoxy]-4-oxobutanoate.
| Compound Name | sodium 4-[(2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propoxy]-4-oxobutanoate |
|---|---|
| PubChem CID | 25104465 |
| Molecular Formula | C16H17Cl2FNNaO7S |
| Molecular Weight | 480.27 g/mol |
| Exact Mass | 479.00 |
| IUPAC Name | sodium 4-[(2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propoxy]-4-oxobutanoate |
| SMILES | CS(=O)(=O)c1ccc(C(OC(=O)CCC(=O)[O-])[C@@H](CF)NC(=O)C(Cl)Cl)cc1.[Na+] |
| InChI | InChI=1S/C16H18Cl2FNO7S.Na/c1-28(25,26)10-4-2-9(3-5-10)14(27-13(23)7-6-12(21)22)11(8-19)20-16(24)15(17)18;/h2-5,11,14-15H,6-8H2,1H3,(H,20,24)(H,21,22);/q;+1/p-1/t11-,14?;/m1./s1 |
| InChIKey | GNTCRYGLFDXASQ-JEVWNTBDSA-M |
| XLogP | -2.53 |
| TPSA | 129.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.27 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|