C16H20Cl2FNO6S — CID 91608812
[(4R,5S)-5-[(2,2-dichloroacetyl)amino]-6-fluoro-4-(4-methylsulfonylphenyl)hexyl] hydrogen carbonate (PubChem CID 91608812) has the molecular formula C16H20Cl2FNO6S and a molecular weight of 444.31 g/mol. Its IUPAC name is [(4R,5S)-5-[(2,2-dichloroacetyl)amino]-6-fluoro-4-(4-methylsulfonylphenyl)hexyl] hydrogen carbonate.
| Compound Name | [(4R,5S)-5-[(2,2-dichloroacetyl)amino]-6-fluoro-4-(4-methylsulfonylphenyl)hexyl] hydrogen carbonate |
|---|---|
| PubChem CID | 91608812 |
| Molecular Formula | C16H20Cl2FNO6S |
| Molecular Weight | 444.31 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | [(4R,5S)-5-[(2,2-dichloroacetyl)amino]-6-fluoro-4-(4-methylsulfonylphenyl)hexyl] hydrogen carbonate |
| SMILES | CS(=O)(=O)c1ccc([C@@H](CCCOC(=O)O)[C@@H](CF)NC(=O)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H20Cl2FNO6S/c1-27(24,25)11-6-4-10(5-7-11)12(3-2-8-26-16(22)23)13(9-19)20-15(21)14(17)18/h4-7,12-14H,2-3,8-9H2,1H3,(H,20,21)(H,22,23)/t12-,13-/m1/s1 |
| InChIKey | MYGNHXQJALHPQU-CHWSQXEVSA-N |
| XLogP | 2.91 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|