C17H22Cl2FNO7S — CID 67365142
[2-[(2,2-dichloroacetyl)amino]-2-[5-fluoro-3-(4-methylsulfonylphenyl)pentan-2-yl]oxyethyl] hydrogen carbonate (PubChem CID 67365142) has the molecular formula C17H22Cl2FNO7S and a molecular weight of 474.33 g/mol. Its IUPAC name is [2-[(2,2-dichloroacetyl)amino]-2-[5-fluoro-3-(4-methylsulfonylphenyl)pentan-2-yl]oxyethyl] hydrogen carbonate.
| Compound Name | [2-[(2,2-dichloroacetyl)amino]-2-[5-fluoro-3-(4-methylsulfonylphenyl)pentan-2-yl]oxyethyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67365142 |
| Molecular Formula | C17H22Cl2FNO7S |
| Molecular Weight | 474.33 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | [2-[(2,2-dichloroacetyl)amino]-2-[5-fluoro-3-(4-methylsulfonylphenyl)pentan-2-yl]oxyethyl] hydrogen carbonate |
| SMILES | CC(OC(COC(=O)O)NC(=O)C(Cl)Cl)C(CCF)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H22Cl2FNO7S/c1-10(28-14(9-27-17(23)24)21-16(22)15(18)19)13(7-8-20)11-3-5-12(6-4-11)29(2,25)26/h3-6,10,13-15H,7-9H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | DDHNSZXAVKNRMC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|