About [2-[(2,2-dichloroacetyl)amino]-3-fluoro-3-(4-methylsulfonylphenyl)propyl] 4-bromobutanoate
[2-[(2,2-dichloroacetyl)amino]-3-fluoro-3-(4-methylsulfonylphenyl)propyl] 4-bromobutanoate (PubChem CID 68803004) has the molecular formula C16H19BrCl2FNO5S
and a molecular weight of 507.21 g/mol. Its IUPAC name is [2-[(2,2-dichloroacetyl)amino]-3-fluoro-3-(4-methylsulfonylphenyl)propyl] 4-bromobutanoate.
Molecular Properties
| Compound Name | [2-[(2,2-dichloroacetyl)amino]-3-fluoro-3-(4-methylsulfonylphenyl)propyl] 4-bromobutanoate |
| PubChem CID | 68803004 |
| Molecular Formula | C16H19BrCl2FNO5S |
| Molecular Weight | 507.21 g/mol |
| Exact Mass | 504.95 |
| IUPAC Name | [2-[(2,2-dichloroacetyl)amino]-3-fluoro-3-(4-methylsulfonylphenyl)propyl] 4-bromobutanoate |
| SMILES | CS(=O)(=O)c1ccc(C(F)C(COC(=O)CCCBr)NC(=O)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H19BrCl2FNO5S/c1-27(24,25)11-6-4-10(5-7-11)14(20)12(21-16(23)15(18)19)9-26-13(22)3-2-8-17/h4-7,12,14-15H,2-3,8-9H2,1H3,(H,21,23) |
| InChIKey | JZUZQIBXMSCHQN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 507.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2,2-dichloroacetyl)amino]-3-fluoro-3-(4-methylsulfonylphenyl)propyl] 4-bromobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,2-dichloroacetyl)amino]-3-fluoro-3-(4-methylsulfonylphenyl)propyl] 4-bromobutanoate?
The IUPAC name of [2-[(2,2-dichloroacetyl)amino]-3-fluoro-3-(4-methylsulfonylphenyl)propyl] 4-bromobutanoate (CID 68803004) is [2-[(2,2-dichloroacetyl)amino]-3-fluoro-3-(4-methylsulfonylphenyl)propyl] 4-bromobutanoate.
What is the SMILES notation for [2-[(2,2-dichloroacetyl)amino]-3-fluoro-3-(4-methylsulfonylphenyl)propyl] 4-bromobutanoate?
The canonical SMILES for [2-[(2,2-dichloroacetyl)amino]-3-fluoro-3-(4-methylsulfonylphenyl)propyl] 4-bromobutanoate is CS(=O)(=O)c1ccc(C(F)C(COC(=O)CCCBr)NC(=O)C(Cl)Cl)cc1.
What is the InChIKey of [2-[(2,2-dichloroacetyl)amino]-3-fluoro-3-(4-methylsulfonylphenyl)propyl] 4-bromobutanoate?
The InChIKey is JZUZQIBXMSCHQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19BrCl2FNO5S/c1-27(24,25)11-6-4-10(5-7-11)14(20)12(21-16(23)15(18)19)9-26-13(22)3-2-8-17/h4-7,12,14-15H,2-3,8-9H2,1H3,(H,21,23).
What are the key properties of [2-[(2,2-dichloroacetyl)amino]-3-fluoro-3-(4-methylsulfonylphenyl)propyl] 4-bromobutanoate?
[2-[(2,2-dichloroacetyl)amino]-3-fluoro-3-(4-methylsulfonylphenyl)propyl] 4-bromobutanoate has a molecular weight of 507.21 g/mol, XLogP of 3.11, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,2-dichloroacetyl)amino]-3-fluoro-3-(4-methylsulfonylphenyl)propyl] 4-bromobutanoate is sourced from PubChem (CID 68803004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).