C16H20Cl2FN3O6S — CID 24990301
[(1R,2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propyl] 2-[(2-aminoacetyl)amino]acetate (PubChem CID 24990301) has the molecular formula C16H20Cl2FN3O6S and a molecular weight of 472.32 g/mol. Its IUPAC name is [(1R,2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propyl] 2-[(2-aminoacetyl)amino]acetate.
| Compound Name | [(1R,2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propyl] 2-[(2-aminoacetyl)amino]acetate |
|---|---|
| PubChem CID | 24990301 |
| Molecular Formula | C16H20Cl2FN3O6S |
| Molecular Weight | 472.32 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | [(1R,2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propyl] 2-[(2-aminoacetyl)amino]acetate |
| SMILES | CS(=O)(=O)c1ccc([C@@H](OC(=O)CNC(=O)CN)[C@@H](CF)NC(=O)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H20Cl2FN3O6S/c1-29(26,27)10-4-2-9(3-5-10)14(11(6-19)22-16(25)15(17)18)28-13(24)8-21-12(23)7-20/h2-5,11,14-15H,6-8,20H2,1H3,(H,21,23)(H,22,25)/t11-,14-/m1/s1 |
| InChIKey | GWYYMRJOKPDCDZ-BXUZGUMPSA-N |
| XLogP | 0.01 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.32 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|