C16H22Cl3FN2O6S — CID 24990645
[(1R,2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propyl] 2-(2-aminoethoxy)acetate;hydrochloride (PubChem CID 24990645) has the molecular formula C16H22Cl3FN2O6S and a molecular weight of 495.78 g/mol. Its IUPAC name is [(1R,2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propyl] 2-(2-aminoethoxy)acetate;hydrochloride.
| Compound Name | [(1R,2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propyl] 2-(2-aminoethoxy)acetate;hydrochloride |
|---|---|
| PubChem CID | 24990645 |
| Molecular Formula | C16H22Cl3FN2O6S |
| Molecular Weight | 495.78 g/mol |
| Exact Mass | 494.02 |
| IUPAC Name | [(1R,2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-(4-methylsulfonylphenyl)propyl] 2-(2-aminoethoxy)acetate;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc([C@@H](OC(=O)COCCN)[C@@H](CF)NC(=O)C(Cl)Cl)cc1.Cl |
| InChI | InChI=1S/C16H21Cl2FN2O6S.ClH/c1-28(24,25)11-4-2-10(3-5-11)14(27-13(22)9-26-7-6-20)12(8-19)21-16(23)15(17)18;/h2-5,12,14-15H,6-9,20H2,1H3,(H,21,23);1H/t12-,14-;/m1./s1 |
| InChIKey | WJINLVJUXUYVRX-QMDUSEKHSA-N |
| XLogP | 1.33 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.78 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|