C20H25BBrCl2NO7S — CID 89266041
CID 89266041 (PubChem CID 89266041) has the molecular formula C20H25BBrCl2NO7S and a molecular weight of 585.11 g/mol.
| Compound Name | CID 89266041 |
|---|---|
| PubChem CID | 89266041 |
| Molecular Formula | C20H25BBrCl2NO7S |
| Molecular Weight | 585.11 g/mol |
| Exact Mass | 583.00 |
| IUPAC Name | — |
| SMILES | [B]CCCC(=O)OC[C@@H](NC(=O)C(Cl)Cl)[C@H](OC(=O)CCCBr)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H25BBrCl2NO7S/c1-33(29,30)14-8-6-13(7-9-14)18(32-17(27)5-3-11-22)15(25-20(28)19(23)24)12-31-16(26)4-2-10-21/h6-9,15,18-19H,2-5,10-12H2,1H3,(H,25,28)/t15-,18-/m1/s1 |
| InChIKey | RAZJFTRTZHALTN-CRAIPNDOSA-N |
| XLogP | 3.05 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.11 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|