About CID 89266041
CID 89266041 (PubChem CID 89266041) has the molecular formula C20H25BBrCl2NO7S
and a molecular weight of 585.11 g/mol.
Molecular Properties
| Compound Name | CID 89266041 |
| PubChem CID | 89266041 |
| Molecular Formula | C20H25BBrCl2NO7S |
| Molecular Weight | 585.11 g/mol |
| Exact Mass | 583.00 |
| IUPAC Name | — |
| SMILES | [B]CCCC(=O)OC[C@@H](NC(=O)C(Cl)Cl)[C@H](OC(=O)CCCBr)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H25BBrCl2NO7S/c1-33(29,30)14-8-6-13(7-9-14)18(32-17(27)5-3-11-22)15(25-20(28)19(23)24)12-31-16(26)4-2-10-21/h6-9,15,18-19H,2-5,10-12H2,1H3,(H,25,28)/t15-,18-/m1/s1 |
| InChIKey | RAZJFTRTZHALTN-CRAIPNDOSA-N |
| XLogP | 3.05 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 585.11 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89266041 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89266041?
The IUPAC name of CID 89266041 (CID 89266041) is not available.
What is the SMILES notation for CID 89266041?
The canonical SMILES for CID 89266041 is [B]CCCC(=O)OC[C@@H](NC(=O)C(Cl)Cl)[C@H](OC(=O)CCCBr)c1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of CID 89266041?
The InChIKey is RAZJFTRTZHALTN-CRAIPNDOSA-N. The full InChI is InChI=1S/C20H25BBrCl2NO7S/c1-33(29,30)14-8-6-13(7-9-14)18(32-17(27)5-3-11-22)15(25-20(28)19(23)24)12-31-16(26)4-2-10-21/h6-9,15,18-19H,2-5,10-12H2,1H3,(H,25,28)/t15-,18-/m1/s1.
What are the key properties of CID 89266041?
CID 89266041 has a molecular weight of 585.11 g/mol, XLogP of 3.05, 14 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89266041 is sourced from PubChem (CID 89266041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).