C24H22Cl2FN3O2 — CID 73056806
3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-spiro[3,4-dihydrochromene-2,3'-azetidine]-7-ylpyridin-2-amine (PubChem CID 73056806) has the molecular formula C24H22Cl2FN3O2 and a molecular weight of 474.36 g/mol. Its IUPAC name is 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-spiro[3,4-dihydrochromene-2,3'-azetidine]-7-ylpyridin-2-amine.
| Compound Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-spiro[3,4-dihydrochromene-2,3'-azetidine]-7-ylpyridin-2-amine |
|---|---|
| PubChem CID | 73056806 |
| Molecular Formula | C24H22Cl2FN3O2 |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-spiro[3,4-dihydrochromene-2,3'-azetidine]-7-ylpyridin-2-amine |
| SMILES | C[C@@H](Oc1cc(-c2ccc3c(c2)OC2(CC3)CNC2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C24H22Cl2FN3O2/c1-13(21-17(25)4-5-18(27)22(21)26)31-20-9-16(10-30-23(20)28)15-3-2-14-6-7-24(11-29-12-24)32-19(14)8-15/h2-5,8-10,13,29H,6-7,11-12H2,1H3,(H2,28,30)/t13-/m1/s1 |
| InChIKey | SEWCVDKBOHQEPF-CYBMUJFWSA-N |
| XLogP | 5.58 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|